About 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine
3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine (PubChem CID 118903771) has the molecular formula C20H13F3N4S
and a molecular weight of 398.41 g/mol. Its IUPAC name is 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine.
Molecular Properties
| Compound Name | 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine |
| PubChem CID | 118903771 |
| Molecular Formula | C20H13F3N4S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine |
| SMILES | Nc1nc(N)c(F)c(-c2cc(-c3ccncc3)c(-c3ccc(F)cc3)s2)c1F |
| InChI | InChI=1S/C20H13F3N4S/c21-12-3-1-11(2-4-12)18-13(10-5-7-26-8-6-10)9-14(28-18)15-16(22)19(24)27-20(25)17(15)23/h1-9H,(H4,24,25,27) |
| InChIKey | NTWJFAOXHCJUCP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine?
The IUPAC name of 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine (CID 118903771) is 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine.
What is the SMILES notation for 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine?
The canonical SMILES for 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine is Nc1nc(N)c(F)c(-c2cc(-c3ccncc3)c(-c3ccc(F)cc3)s2)c1F.
What is the InChIKey of 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine?
The InChIKey is NTWJFAOXHCJUCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F3N4S/c21-12-3-1-11(2-4-12)18-13(10-5-7-26-8-6-10)9-14(28-18)15-16(22)19(24)27-20(25)17(15)23/h1-9H,(H4,24,25,27).
What are the key properties of 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine?
3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine has a molecular weight of 398.41 g/mol, XLogP of 5.12, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-difluoro-4-[5-(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]pyridine-2,6-diamine is sourced from PubChem (CID 118903771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).