C22H20Cl2FN3O3 — CID 118903875
5-[[1-(2,4-dichlorophenyl)-4-isocyanatopiperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 118903875) has the molecular formula C22H20Cl2FN3O3 and a molecular weight of 464.32 g/mol. Its IUPAC name is 5-[[1-(2,4-dichlorophenyl)-4-isocyanatopiperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[[1-(2,4-dichlorophenyl)-4-isocyanatopiperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118903875 |
| Molecular Formula | C22H20Cl2FN3O3 |
| Molecular Weight | 464.32 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 5-[[1-(2,4-dichlorophenyl)-4-isocyanatopiperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C=NC1(COc2ccc(F)c3c2CCC(=O)N3)CCN(c2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C22H20Cl2FN3O3/c23-14-1-4-18(16(24)11-14)28-9-7-22(8-10-28,26-13-29)12-31-19-5-3-17(25)21-15(19)2-6-20(30)27-21/h1,3-5,11H,2,6-10,12H2,(H,27,30) |
| InChIKey | VLXNXQKGEJRGQB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.32 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|