About [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate
[1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 118904033) has the molecular formula C19H20ClF2NO4S
and a molecular weight of 431.89 g/mol. Its IUPAC name is [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate |
| PubChem CID | 118904033 |
| Molecular Formula | C19H20ClF2NO4S |
| Molecular Weight | 431.89 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC2CCN(c3cc(F)c(Cl)cc3F)CC2O)cc1 |
| InChI | InChI=1S/C19H20ClF2NO4S/c1-12-2-4-14(5-3-12)28(25,26)27-11-13-6-7-23(10-19(13)24)18-9-16(21)15(20)8-17(18)22/h2-5,8-9,13,19,24H,6-7,10-11H2,1H3 |
| InChIKey | ODUOUYAREZETHW-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.89 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate?
The IUPAC name of [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate (CID 118904033) is [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate.
What is the SMILES notation for [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate?
The canonical SMILES for [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC2CCN(c3cc(F)c(Cl)cc3F)CC2O)cc1.
What is the InChIKey of [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate?
The InChIKey is ODUOUYAREZETHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20ClF2NO4S/c1-12-2-4-14(5-3-12)28(25,26)27-11-13-6-7-23(10-19(13)24)18-9-16(21)15(20)8-17(18)22/h2-5,8-9,13,19,24H,6-7,10-11H2,1H3.
What are the key properties of [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate?
[1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate has a molecular weight of 431.89 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-chloro-2,5-difluorophenyl)-3-hydroxypiperidin-4-yl]methyl 4-methylbenzenesulfonate is sourced from PubChem (CID 118904033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).