About 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol
1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol (PubChem CID 118904113) has the molecular formula C12H14ClF2NO2
and a molecular weight of 277.70 g/mol. Its IUPAC name is 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol.
Molecular Properties
| Compound Name | 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol |
| PubChem CID | 118904113 |
| Molecular Formula | C12H14ClF2NO2 |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol |
| SMILES | OCC1CCN(c2cc(F)c(Cl)cc2F)CC1O |
| InChI | InChI=1S/C12H14ClF2NO2/c13-8-3-10(15)11(4-9(8)14)16-2-1-7(6-17)12(18)5-16/h3-4,7,12,17-18H,1-2,5-6H2 |
| InChIKey | RNIITKHESYXKOS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol?
The IUPAC name of 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol (CID 118904113) is 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol.
What is the SMILES notation for 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol?
The canonical SMILES for 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol is OCC1CCN(c2cc(F)c(Cl)cc2F)CC1O.
What is the InChIKey of 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol?
The InChIKey is RNIITKHESYXKOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClF2NO2/c13-8-3-10(15)11(4-9(8)14)16-2-1-7(6-17)12(18)5-16/h3-4,7,12,17-18H,1-2,5-6H2.
What are the key properties of 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol?
1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol has a molecular weight of 277.70 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2,5-difluorophenyl)-4-(hydroxymethyl)piperidin-3-ol is sourced from PubChem (CID 118904113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).