C11H10ClF2NO3 — CID 118904156
(3R,5R)-1-(4-chloro-2,6-difluorophenyl)-3,5-dihydroxypiperidin-4-one (PubChem CID 118904156) has the molecular formula C11H10ClF2NO3 and a molecular weight of 277.65 g/mol. Its IUPAC name is (3R,5R)-1-(4-chloro-2,6-difluorophenyl)-3,5-dihydroxypiperidin-4-one.
| Compound Name | (3R,5R)-1-(4-chloro-2,6-difluorophenyl)-3,5-dihydroxypiperidin-4-one |
|---|---|
| PubChem CID | 118904156 |
| Molecular Formula | C11H10ClF2NO3 |
| Molecular Weight | 277.65 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (3R,5R)-1-(4-chloro-2,6-difluorophenyl)-3,5-dihydroxypiperidin-4-one |
| SMILES | O=C1[C@H](O)CN(c2c(F)cc(Cl)cc2F)C[C@H]1O |
| InChI | InChI=1S/C11H10ClF2NO3/c12-5-1-6(13)10(7(14)2-5)15-3-8(16)11(18)9(17)4-15/h1-2,8-9,16-17H,3-4H2/t8-,9-/m1/s1 |
| InChIKey | RDHIWCZWCCNNGZ-RKDXNWHRSA-N |
| XLogP | 0.73 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.65 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |