About 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one
1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one (PubChem CID 118904251) has the molecular formula C19H18ClF2NO3
and a molecular weight of 381.81 g/mol. Its IUPAC name is 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one.
Molecular Properties
| Compound Name | 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one |
| PubChem CID | 118904251 |
| Molecular Formula | C19H18ClF2NO3 |
| Molecular Weight | 381.81 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one |
| SMILES | COc1ccc(COC2CN(c3c(F)cc(Cl)cc3F)CCC2=O)cc1 |
| InChI | InChI=1S/C19H18ClF2NO3/c1-25-14-4-2-12(3-5-14)11-26-18-10-23(7-6-17(18)24)19-15(21)8-13(20)9-16(19)22/h2-5,8-9,18H,6-7,10-11H2,1H3 |
| InChIKey | SEAWIQORHVGNPX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.81 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one?
The IUPAC name of 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one (CID 118904251) is 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one.
What is the SMILES notation for 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one?
The canonical SMILES for 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one is COc1ccc(COC2CN(c3c(F)cc(Cl)cc3F)CCC2=O)cc1.
What is the InChIKey of 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one?
The InChIKey is SEAWIQORHVGNPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClF2NO3/c1-25-14-4-2-12(3-5-14)11-26-18-10-23(7-6-17(18)24)19-15(21)8-13(20)9-16(19)22/h2-5,8-9,18H,6-7,10-11H2,1H3.
What are the key properties of 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one?
1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one has a molecular weight of 381.81 g/mol, XLogP of 3.99, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-2,6-difluorophenyl)-3-[(4-methoxyphenyl)methoxy]piperidin-4-one is sourced from PubChem (CID 118904251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).