C21H21Cl2F2N3O2 — CID 118904779
5-[[4-amino-1-(2,5-dichloro-4-fluorophenyl)piperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 118904779) has the molecular formula C21H21Cl2F2N3O2 and a molecular weight of 456.32 g/mol. Its IUPAC name is 5-[[4-amino-1-(2,5-dichloro-4-fluorophenyl)piperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[[4-amino-1-(2,5-dichloro-4-fluorophenyl)piperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118904779 |
| Molecular Formula | C21H21Cl2F2N3O2 |
| Molecular Weight | 456.32 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | 5-[[4-amino-1-(2,5-dichloro-4-fluorophenyl)piperidin-4-yl]methoxy]-8-fluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | NC1(COc2ccc(F)c3c2CCC(=O)N3)CCN(c2cc(Cl)c(F)cc2Cl)CC1 |
| InChI | InChI=1S/C21H21Cl2F2N3O2/c22-13-10-17(14(23)9-16(13)25)28-7-5-21(26,6-8-28)11-30-18-3-2-15(24)20-12(18)1-4-19(29)27-20/h2-3,9-10H,1,4-8,11,26H2,(H,27,29) |
| InChIKey | YLAHKEAPLAMHLF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|