C32H54O4S — CID 118905009
bis(1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-yl) sulfate (PubChem CID 118905009) has the molecular formula C32H54O4S and a molecular weight of 534.85 g/mol. Its IUPAC name is bis(1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-yl) sulfate.
| Compound Name | bis(1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-yl) sulfate |
|---|---|
| PubChem CID | 118905009 |
| Molecular Formula | C32H54O4S |
| Molecular Weight | 534.85 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | bis(1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-yl) sulfate |
| SMILES | CC1(C)C(OS(=O)(=O)OC2CCC3C4CCCCC4CCC3C2(C)C)CCC2C3CCCCC3CCC21 |
| InChI | InChI=1S/C32H54O4S/c1-31(2)27-17-13-21-9-5-7-11-23(21)25(27)15-19-29(31)35-37(33,34)36-30-20-16-26-24-12-8-6-10-22(24)14-18-28(26)32(30,3)4/h21-30H,5-20H2,1-4H3 |
| InChIKey | KBRDCZAHSLJNIB-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.85 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |