C16H28O — CID 118905117
1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-ol (PubChem CID 118905117) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is 1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-ol.
| Compound Name | 1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-ol |
|---|---|
| PubChem CID | 118905117 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | 1,1-dimethyl-3,4,4a,4b,5,6,7,8,8a,9,10,10a-dodecahydro-2H-phenanthren-2-ol |
| SMILES | CC1(C)C(O)CCC2C3CCCCC3CCC21 |
| InChI | InChI=1S/C16H28O/c1-16(2)14-9-7-11-5-3-4-6-12(11)13(14)8-10-15(16)17/h11-15,17H,3-10H2,1-2H3 |
| InChIKey | SLYSPVOVIYVYLR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |