About 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide
3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide (PubChem CID 118905643) has the molecular formula C19H14F3N5O3
and a molecular weight of 417.35 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide.
Molecular Properties
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide |
| PubChem CID | 118905643 |
| Molecular Formula | C19H14F3N5O3 |
| Molecular Weight | 417.35 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide |
| SMILES | NC(=O)c1cccc(Nc2nc(Nc3ccc4c(c3)OCO4)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C19H14F3N5O3/c20-19(21,22)13-8-24-18(26-12-4-5-14-15(7-12)30-9-29-14)27-17(13)25-11-3-1-2-10(6-11)16(23)28/h1-8H,9H2,(H2,23,28)(H2,24,25,26,27) |
| InChIKey | VGHFAFWEBKZNLM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 111.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide?
The IUPAC name of 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide (CID 118905643) is 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide.
What is the SMILES notation for 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide?
The canonical SMILES for 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide is NC(=O)c1cccc(Nc2nc(Nc3ccc4c(c3)OCO4)ncc2C(F)(F)F)c1.
What is the InChIKey of 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide?
The InChIKey is VGHFAFWEBKZNLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14F3N5O3/c20-19(21,22)13-8-24-18(26-12-4-5-14-15(7-12)30-9-29-14)27-17(13)25-11-3-1-2-10(6-11)16(23)28/h1-8H,9H2,(H2,23,28)(H2,24,25,26,27).
What are the key properties of 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide?
3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide has a molecular weight of 417.35 g/mol, XLogP of 3.81, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2-(1,3-benzodioxol-5-ylamino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]benzamide is sourced from PubChem (CID 118905643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).