About 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one
1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one (PubChem CID 118905682) has the molecular formula C22H22BrN3O5
and a molecular weight of 488.34 g/mol. Its IUPAC name is 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one.
Molecular Properties
| Compound Name | 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one |
| PubChem CID | 118905682 |
| Molecular Formula | C22H22BrN3O5 |
| Molecular Weight | 488.34 g/mol |
| Exact Mass | 487.07 |
| IUPAC Name | 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one |
| SMILES | CCC(=O)c1ccccc1Oc1nc(Nc2cc(OC)c(OC)c(OC)c2)ncc1Br |
| InChI | InChI=1S/C22H22BrN3O5/c1-5-16(27)14-8-6-7-9-17(14)31-21-15(23)12-24-22(26-21)25-13-10-18(28-2)20(30-4)19(11-13)29-3/h6-12H,5H2,1-4H3,(H,24,25,26) |
| InChIKey | ACWPUAWLUPXIHH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.34 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one?
The IUPAC name of 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one (CID 118905682) is 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one.
What is the SMILES notation for 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one?
The canonical SMILES for 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one is CCC(=O)c1ccccc1Oc1nc(Nc2cc(OC)c(OC)c(OC)c2)ncc1Br.
What is the InChIKey of 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one?
The InChIKey is ACWPUAWLUPXIHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22BrN3O5/c1-5-16(27)14-8-6-7-9-17(14)31-21-15(23)12-24-22(26-21)25-13-10-18(28-2)20(30-4)19(11-13)29-3/h6-12H,5H2,1-4H3,(H,24,25,26).
What are the key properties of 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one?
1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one has a molecular weight of 488.34 g/mol, XLogP of 5.39, 9 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[5-bromo-2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]oxyphenyl]propan-1-one is sourced from PubChem (CID 118905682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).