C19H13F3N4O4 — CID 118905862
2-N,4-N-bis(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 118905862) has the molecular formula C19H13F3N4O4 and a molecular weight of 418.33 g/mol. Its IUPAC name is 2-N,4-N-bis(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 118905862 |
| Molecular Formula | C19H13F3N4O4 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 2-N,4-N-bis(1,3-benzodioxol-5-yl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)c1cnc(Nc2ccc3c(c2)OCO3)nc1Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H13F3N4O4/c20-19(21,22)12-7-23-18(25-11-2-4-14-16(6-11)30-9-28-14)26-17(12)24-10-1-3-13-15(5-10)29-8-27-13/h1-7H,8-9H2,(H2,23,24,25,26) |
| InChIKey | OZZHIGXRJGFYLN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 86.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |