C25H26N2O2S — CID 11890598
[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-thiophen-2-ylacetate (PubChem CID 11890598) has the molecular formula C25H26N2O2S and a molecular weight of 418.56 g/mol. Its IUPAC name is [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-thiophen-2-ylacetate.
| Compound Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 11890598 |
| Molecular Formula | C25H26N2O2S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-thiophen-2-ylacetate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OC(=O)Cc1cccs1)c1ccnc2ccccc12 |
| InChI | InChI=1S/C25H26N2O2S/c1-2-17-16-27-12-10-18(17)14-23(27)25(29-24(28)15-19-6-5-13-30-19)21-9-11-26-22-8-4-3-7-20(21)22/h2-9,11,13,17-18,23,25H,1,10,12,14-16H2/t17-,18-,23+,25-/m0/s1 |
| InChIKey | XERZUJXLGBDHHI-RQDMQHKKSA-N |
| XLogP | 5.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|