C17H19Cl4N3O3 — CID 118906072
[3-tert-butyl-1-(3-chloro-4-methoxyphenyl)-4-(2,2,2-trichloroethyl)pyrazol-5-yl] carbamate (PubChem CID 118906072) has the molecular formula C17H19Cl4N3O3 and a molecular weight of 455.17 g/mol. Its IUPAC name is [3-tert-butyl-1-(3-chloro-4-methoxyphenyl)-4-(2,2,2-trichloroethyl)pyrazol-5-yl] carbamate.
| Compound Name | [3-tert-butyl-1-(3-chloro-4-methoxyphenyl)-4-(2,2,2-trichloroethyl)pyrazol-5-yl] carbamate |
|---|---|
| PubChem CID | 118906072 |
| Molecular Formula | C17H19Cl4N3O3 |
| Molecular Weight | 455.17 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | [3-tert-butyl-1-(3-chloro-4-methoxyphenyl)-4-(2,2,2-trichloroethyl)pyrazol-5-yl] carbamate |
| SMILES | COc1ccc(-n2nc(C(C)(C)C)c(CC(Cl)(Cl)Cl)c2OC(N)=O)cc1Cl |
| InChI | InChI=1S/C17H19Cl4N3O3/c1-16(2,3)13-10(8-17(19,20)21)14(27-15(22)25)24(23-13)9-5-6-12(26-4)11(18)7-9/h5-7H,8H2,1-4H3,(H2,22,25) |
| InChIKey | FWUJHZOTXOQSLZ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.17 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|