C8H8F3N3 — CID 118906435
(2E,4E)-2,5-diamino-3-(trifluoromethyl)hepta-2,4,6-trienenitrile (PubChem CID 118906435) has the molecular formula C8H8F3N3 and a molecular weight of 203.17 g/mol. Its IUPAC name is (2E,4E)-2,5-diamino-3-(trifluoromethyl)hepta-2,4,6-trienenitrile.
| Compound Name | (2E,4E)-2,5-diamino-3-(trifluoromethyl)hepta-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 118906435 |
| Molecular Formula | C8H8F3N3 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (2E,4E)-2,5-diamino-3-(trifluoromethyl)hepta-2,4,6-trienenitrile |
| SMILES | C=C/C(N)=C\C(=C(/N)C#N)C(F)(F)F |
| InChI | InChI=1S/C8H8F3N3/c1-2-5(13)3-6(7(14)4-12)8(9,10)11/h2-3H,1,13-14H2/b5-3+,7-6+ |
| InChIKey | KXQAHCDKVNGBCG-TWTPFVCWSA-N |
| XLogP | 1.31 |
| TPSA | 75.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|