About N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide
N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide (PubChem CID 118906538) has the molecular formula C9H16ClN3
and a molecular weight of 201.70 g/mol. Its IUPAC name is N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide.
Molecular Properties
| Compound Name | N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide |
| PubChem CID | 118906538 |
| Molecular Formula | C9H16ClN3 |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide |
| SMILES | C=C(Cl)/C=C(\C)N/C=N/CCNC |
| InChI | InChI=1S/C9H16ClN3/c1-8(10)6-9(2)13-7-12-5-4-11-3/h6-7,11H,1,4-5H2,2-3H3,(H,12,13)/b9-6+ |
| InChIKey | AZQHPUVAOCCAPQ-RMKNXTFCSA-N |
| XLogP | 1.48 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide?
The IUPAC name of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide (CID 118906538) is N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide.
What is the SMILES notation for N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide?
The canonical SMILES for N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide is C=C(Cl)/C=C(\C)N/C=N/CCNC.
What is the InChIKey of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide?
The InChIKey is AZQHPUVAOCCAPQ-RMKNXTFCSA-N. The full InChI is InChI=1S/C9H16ClN3/c1-8(10)6-9(2)13-7-12-5-4-11-3/h6-7,11H,1,4-5H2,2-3H3,(H,12,13)/b9-6+.
What are the key properties of N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide?
N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide has a molecular weight of 201.70 g/mol, XLogP of 1.48, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-4-chloropenta-2,4-dien-2-yl]-N'-[2-(methylamino)ethyl]methanimidamide is sourced from PubChem (CID 118906538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).