About (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate
(2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate (PubChem CID 118906601) has the molecular formula C15H15F2NO8S2
and a molecular weight of 439.41 g/mol. Its IUPAC name is (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate.
Molecular Properties
| Compound Name | (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate |
| PubChem CID | 118906601 |
| Molecular Formula | C15H15F2NO8S2 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.02 |
| IUPAC Name | (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate |
| SMILES | C=Cc1ccc(S(=O)(=O)N(C)S(=O)(=O)C(F)(F)C(=O)OC2CCOC2=O)cc1 |
| InChI | InChI=1S/C15H15F2NO8S2/c1-3-10-4-6-11(7-5-10)27(21,22)18(2)28(23,24)15(16,17)14(20)26-12-8-9-25-13(12)19/h3-7,12H,1,8-9H2,2H3 |
| InChIKey | MFRLCXBNHLZXBS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 124.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate?
The IUPAC name of (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate (CID 118906601) is (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate.
What is the SMILES notation for (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate?
The canonical SMILES for (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate is C=Cc1ccc(S(=O)(=O)N(C)S(=O)(=O)C(F)(F)C(=O)OC2CCOC2=O)cc1.
What is the InChIKey of (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate?
The InChIKey is MFRLCXBNHLZXBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2NO8S2/c1-3-10-4-6-11(7-5-10)27(21,22)18(2)28(23,24)15(16,17)14(20)26-12-8-9-25-13(12)19/h3-7,12H,1,8-9H2,2H3.
What are the key properties of (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate?
(2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate has a molecular weight of 439.41 g/mol, XLogP of 0.73, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxooxolan-3-yl) 2-[(4-ethenylphenyl)sulfonyl-methylsulfamoyl]-2,2-difluoroacetate is sourced from PubChem (CID 118906601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).