C56H37FN4 — CID 118906658
4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-5-phenylbenzene-1,3-dicarbonitrile (PubChem CID 118906658) has the molecular formula C56H37FN4 and a molecular weight of 784.94 g/mol. Its IUPAC name is 4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-5-phenylbenzene-1,3-dicarbonitrile.
| Compound Name | 4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-5-phenylbenzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 118906658 |
| Molecular Formula | C56H37FN4 |
| Molecular Weight | 784.94 g/mol |
| Exact Mass | 784.30 |
| IUPAC Name | 4,6-bis(7,7-dimethylindeno[2,1-b]carbazol-5-yl)-2-fluoro-5-phenylbenzene-1,3-dicarbonitrile |
| SMILES | CC1(C)c2ccccc2-c2cc3c4ccccc4n(-c4c(C#N)c(F)c(C#N)c(-n5c6ccccc6c6cc7c(cc65)C(C)(C)c5ccccc5-7)c4-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C56H37FN4/c1-55(2)43-22-12-8-18-33(43)37-26-39-35-20-10-14-24-47(35)60(49(39)28-45(37)55)53-41(30-58)52(57)42(31-59)54(51(53)32-16-6-5-7-17-32)61-48-25-15-11-21-36(48)40-27-38-34-19-9-13-23-44(34)56(3,4)46(38)29-50(40)61/h5-29H,1-4H3 |
| InChIKey | RTCHWMCRGHVTIJ-UHFFFAOYSA-N |
| XLogP | 14.04 |
| TPSA | 57.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.94 |
| LogP ≤ 5 | 14.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |