C16H18FNO2 — CID 11890740
(3aS,5R,7aS)-2-(5-fluoro-2-methylphenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 11890740) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is (3aS,5R,7aS)-2-(5-fluoro-2-methylphenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aS,5R,7aS)-2-(5-fluoro-2-methylphenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 11890740 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (3aS,5R,7aS)-2-(5-fluoro-2-methylphenyl)-5-methyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | Cc1ccc(F)cc1N1C(=O)[C@H]2CC[C@@H](C)C[C@@H]2C1=O |
| InChI | InChI=1S/C16H18FNO2/c1-9-3-6-12-13(7-9)16(20)18(15(12)19)14-8-11(17)5-4-10(14)2/h4-5,8-9,12-13H,3,6-7H2,1-2H3/t9-,12+,13+/m1/s1 |
| InChIKey | SXKBVWAZELLUNF-ICCXJUOJSA-N |
| XLogP | 3.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|