C31H34O6 — CID 118907401
[2,5-bis[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,5-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 118907401) has the molecular formula C31H34O6 and a molecular weight of 502.61 g/mol. Its IUPAC name is [2,5-bis[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,5-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [2,5-bis[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,5-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 118907401 |
| Molecular Formula | C31H34O6 |
| Molecular Weight | 502.61 g/mol |
| Exact Mass | 502.24 |
| IUPAC Name | [2,5-bis[4-(2-methylprop-2-enoyloxy)cyclohexa-1,3-dien-1-yl]cyclohexa-1,5-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C=C(C)C(=O)OC1=CC=C(C2=CC(OC(=O)/C(C)=C\C)=C(C3=CC=C(OC(=O)C(=C)C)CC3)CC2)CC1 |
| InChI | InChI=1S/C31H34O6/c1-7-21(6)31(34)37-28-18-24(22-8-13-25(14-9-22)35-29(32)19(2)3)12-17-27(28)23-10-15-26(16-11-23)36-30(33)20(4)5/h7-8,10,13,15,18H,2,4,9,11-12,14,16-17H2,1,3,5-6H3/b21-7- |
| InChIKey | FOKQRJDGWZMAHO-YXSASFKJSA-N |
| XLogP | 6.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.61 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|