About 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene
1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene (PubChem CID 118907614) has the molecular formula C30H34O6
and a molecular weight of 490.60 g/mol. Its IUPAC name is 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene.
Molecular Properties
| Compound Name | 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene |
| PubChem CID | 118907614 |
| Molecular Formula | C30H34O6 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene |
| SMILES | C/C=C/COc1cc(-c2ccc(OCOC)cc2)c(OC/C=C/C)cc1-c1ccc(OCOC)cc1 |
| InChI | InChI=1S/C30H34O6/c1-5-7-17-33-29-19-28(24-11-15-26(16-12-24)36-22-32-4)30(34-18-8-6-2)20-27(29)23-9-13-25(14-10-23)35-21-31-3/h5-16,19-20H,17-18,21-22H2,1-4H3/b7-5+,8-6+ |
| InChIKey | JJRPXZMNHIUGJW-KQQUZDAGSA-N |
| XLogP | 6.90 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene?
The IUPAC name of 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene (CID 118907614) is 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene.
What is the SMILES notation for 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene?
The canonical SMILES for 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene is C/C=C/COc1cc(-c2ccc(OCOC)cc2)c(OC/C=C/C)cc1-c1ccc(OCOC)cc1.
What is the InChIKey of 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene?
The InChIKey is JJRPXZMNHIUGJW-KQQUZDAGSA-N. The full InChI is InChI=1S/C30H34O6/c1-5-7-17-33-29-19-28(24-11-15-26(16-12-24)36-22-32-4)30(34-18-8-6-2)20-27(29)23-9-13-25(14-10-23)35-21-31-3/h5-16,19-20H,17-18,21-22H2,1-4H3/b7-5+,8-6+.
What are the key properties of 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene?
1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene has a molecular weight of 490.60 g/mol, XLogP of 6.90, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis[(E)-but-2-enoxy]-2,5-bis[4-(methoxymethoxy)phenyl]benzene is sourced from PubChem (CID 118907614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).