C22H23FN4O — CID 118907833
1-N'-diazenyl-1-N-[2-[[3-(4-fluorophenyl)cyclohexa-1,3-dien-1-yl]oxymethyl]phenyl]-1-N'-methylethene-1,1-diamine (PubChem CID 118907833) has the molecular formula C22H23FN4O and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-N'-diazenyl-1-N-[2-[[3-(4-fluorophenyl)cyclohexa-1,3-dien-1-yl]oxymethyl]phenyl]-1-N'-methylethene-1,1-diamine.
| Compound Name | 1-N'-diazenyl-1-N-[2-[[3-(4-fluorophenyl)cyclohexa-1,3-dien-1-yl]oxymethyl]phenyl]-1-N'-methylethene-1,1-diamine |
|---|---|
| PubChem CID | 118907833 |
| Molecular Formula | C22H23FN4O |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1-N'-diazenyl-1-N-[2-[[3-(4-fluorophenyl)cyclohexa-1,3-dien-1-yl]oxymethyl]phenyl]-1-N'-methylethene-1,1-diamine |
| SMILES | [H]/N=N/N(C)C(=C)Nc1ccccc1COC1=CC(c2ccc(F)cc2)=CCC1 |
| InChI | InChI=1S/C22H23FN4O/c1-16(27(2)26-24)25-22-9-4-3-6-19(22)15-28-21-8-5-7-18(14-21)17-10-12-20(23)13-11-17/h3-4,6-7,9-14,24-25H,1,5,8,15H2,2H3/b26-24+ |
| InChIKey | CGZRTMOIQRNNHX-SHHOIMCASA-N |
| XLogP | 5.86 |
| TPSA | 60.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|