About 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine
2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 118908048) has the molecular formula C11H13F3N4
and a molecular weight of 258.25 g/mol. Its IUPAC name is 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| PubChem CID | 118908048 |
| Molecular Formula | C11H13F3N4 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)c1cnc(NC2CC2)nc1NC1CC1 |
| InChI | InChI=1S/C11H13F3N4/c12-11(13,14)8-5-15-10(17-7-3-4-7)18-9(8)16-6-1-2-6/h5-7H,1-4H2,(H2,15,16,17,18) |
| InChIKey | OYDQBDBGKOLVPE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The IUPAC name of 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine (CID 118908048) is 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine is FC(F)(F)c1cnc(NC2CC2)nc1NC1CC1.
What is the InChIKey of 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The InChIKey is OYDQBDBGKOLVPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F3N4/c12-11(13,14)8-5-15-10(17-7-3-4-7)18-9(8)16-6-1-2-6/h5-7H,1-4H2,(H2,15,16,17,18).
What are the key properties of 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine?
2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine has a molecular weight of 258.25 g/mol, XLogP of 2.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-dicyclopropyl-5-(trifluoromethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 118908048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).