C13H24O9S — CID 118908293
(2R,4S,5R)-2-[(3R,4R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methyloxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol (PubChem CID 118908293) has the molecular formula C13H24O9S and a molecular weight of 356.39 g/mol. Its IUPAC name is (2R,4S,5R)-2-[(3R,4R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methyloxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol.
| Compound Name | (2R,4S,5R)-2-[(3R,4R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methyloxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118908293 |
| Molecular Formula | C13H24O9S |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | (2R,4S,5R)-2-[(3R,4R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-methyloxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol |
| SMILES | C[C@@H]1OC(CO)[C@H](O[C@@H]2OC(CS)[C@H](O)[C@H](O)C2O)[C@H](O)C1O |
| InChI | InChI=1S/C13H24O9S/c1-4-7(15)10(18)12(5(2-14)20-4)22-13-11(19)9(17)8(16)6(3-23)21-13/h4-19,23H,2-3H2,1H3/t4-,5?,6?,7?,8-,9-,10+,11?,12-,13-/m0/s1 |
| InChIKey | DNGGQIWGVAZEDX-AMSVOLHASA-N |
| XLogP | -3.39 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | -3.39 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|