C18H34O10S — CID 118908296
(2R,4S,5R)-2-[(3S,4R,6S)-6-hexoxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol (PubChem CID 118908296) has the molecular formula C18H34O10S and a molecular weight of 442.53 g/mol. Its IUPAC name is (2R,4S,5R)-2-[(3S,4R,6S)-6-hexoxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol.
| Compound Name | (2R,4S,5R)-2-[(3S,4R,6S)-6-hexoxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118908296 |
| Molecular Formula | C18H34O10S |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | (2R,4S,5R)-2-[(3S,4R,6S)-6-hexoxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-6-(sulfanylmethyl)oxane-3,4,5-triol |
| SMILES | CCCCCCO[C@H]1OC(CO)[C@@H](O[C@@H]2OC(CS)[C@H](O)[C@H](O)C2O)[C@H](O)C1O |
| InChI | InChI=1S/C18H34O10S/c1-2-3-4-5-6-25-17-15(24)13(22)16(9(7-19)26-17)28-18-14(23)12(21)11(20)10(8-29)27-18/h9-24,29H,2-8H2,1H3/t9?,10?,11-,12-,13+,14?,15?,16+,17-,18-/m0/s1 |
| InChIKey | XGBBCPKDFLTSHZ-VQFQHRHBSA-N |
| XLogP | -1.86 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | -1.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|