C25H22Cl2F2N2O5 — CID 118908628
4-[4-[3,6-dichloro-2-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]oxy-1H-pyrrolo[3,2-b]pyridin-5-yl]-3,5-difluorophenyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 118908628) has the molecular formula C25H22Cl2F2N2O5 and a molecular weight of 539.36 g/mol. Its IUPAC name is 4-[4-[3,6-dichloro-2-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]oxy-1H-pyrrolo[3,2-b]pyridin-5-yl]-3,5-difluorophenyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[4-[3,6-dichloro-2-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]oxy-1H-pyrrolo[3,2-b]pyridin-5-yl]-3,5-difluorophenyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 118908628 |
| Molecular Formula | C25H22Cl2F2N2O5 |
| Molecular Weight | 539.36 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 4-[4-[3,6-dichloro-2-[(3S,5S)-5-(hydroxymethyl)oxolan-3-yl]oxy-1H-pyrrolo[3,2-b]pyridin-5-yl]-3,5-difluorophenyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | O=C(O)C1CC=C(c2cc(F)c(-c3nc4c(Cl)c(O[C@@H]5CO[C@H](CO)C5)[nH]c4cc3Cl)c(F)c2)CC1 |
| InChI | InChI=1S/C25H22Cl2F2N2O5/c26-16-8-19-23(21(27)24(30-19)36-15-7-14(9-32)35-10-15)31-22(16)20-17(28)5-13(6-18(20)29)11-1-3-12(4-2-11)25(33)34/h1,5-6,8,12,14-15,30,32H,2-4,7,9-10H2,(H,33,34)/t12?,14-,15-/m0/s1 |
| InChIKey | KDIKDDKARCICQU-ZRNAQANOSA-N |
| XLogP | 5.61 |
| TPSA | 104.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |