C29H28FN3O5S — CID 118908864
(3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[(1-oxothiolan-1-ylidene)amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118908864) has the molecular formula C29H28FN3O5S and a molecular weight of 549.62 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[(1-oxothiolan-1-ylidene)amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[(1-oxothiolan-1-ylidene)amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118908864 |
| Molecular Formula | C29H28FN3O5S |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-fluoro-5-[4-[4-[(1-oxothiolan-1-ylidene)amino]phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O=S1(=Nc2ccc(-c3ccc(-c4nc5cc(O[C@@H]6CO[C@H]7[C@@H]6OC[C@H]7O)[nH]c5cc4F)cc3)cc2)CCCC1 |
| InChI | InChI=1S/C29H28FN3O5S/c30-21-13-22-23(14-26(31-22)38-25-16-37-28-24(34)15-36-29(25)28)32-27(21)19-5-3-17(4-6-19)18-7-9-20(10-8-18)33-39(35)11-1-2-12-39/h3-10,13-14,24-25,28-29,31,34H,1-2,11-12,15-16H2/t24-,25-,28-,29-/m1/s1 |
| InChIKey | AHWBHKJDRRTZCK-WPUBFDFZSA-N |
| XLogP | 4.84 |
| TPSA | 106.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |