C29H25FN2O5 — CID 118908881
[2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclopropyl]-phenylmethanone (PubChem CID 118908881) has the molecular formula C29H25FN2O5 and a molecular weight of 500.53 g/mol. Its IUPAC name is [2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclopropyl]-phenylmethanone.
| Compound Name | [2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclopropyl]-phenylmethanone |
|---|---|
| PubChem CID | 118908881 |
| Molecular Formula | C29H25FN2O5 |
| Molecular Weight | 500.53 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | [2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]cyclopropyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1CC1c1ccc(-c2nc3cc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2F)cc1 |
| InChI | InChI=1S/C29H25FN2O5/c30-20-11-21-22(12-25(31-21)37-24-14-36-28-23(33)13-35-29(24)28)32-26(20)16-8-6-15(7-9-16)18-10-19(18)27(34)17-4-2-1-3-5-17/h1-9,11-12,18-19,23-24,28-29,31,33H,10,13-14H2/t18?,19?,23-,24-,28-,29-/m1/s1 |
| InChIKey | CHEPXUIZQXTNNA-LBAWXFLLSA-N |
| XLogP | 4.26 |
| TPSA | 93.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |