About 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole
6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole (PubChem CID 118908922) has the molecular formula C21H15ClF3NO
and a molecular weight of 389.80 g/mol. Its IUPAC name is 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole.
Molecular Properties
| Compound Name | 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole |
| PubChem CID | 118908922 |
| Molecular Formula | C21H15ClF3NO |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole |
| SMILES | FC(F)(F)CC(c1ccco1)c1c(-c2ccccc2)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H15ClF3NO/c22-14-8-9-15-17(11-14)26-20(13-5-2-1-3-6-13)19(15)16(12-21(23,24)25)18-7-4-10-27-18/h1-11,16,26H,12H2 |
| InChIKey | LZCIUQDWSIYVCY-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole?
The IUPAC name of 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole (CID 118908922) is 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole.
What is the SMILES notation for 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole?
The canonical SMILES for 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole is FC(F)(F)CC(c1ccco1)c1c(-c2ccccc2)[nH]c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole?
The InChIKey is LZCIUQDWSIYVCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H15ClF3NO/c22-14-8-9-15-17(11-14)26-20(13-5-2-1-3-6-13)19(15)16(12-21(23,24)25)18-7-4-10-27-18/h1-11,16,26H,12H2.
What are the key properties of 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole?
6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole has a molecular weight of 389.80 g/mol, XLogP of 7.17, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-phenyl-3-[3,3,3-trifluoro-1-(furan-2-yl)propyl]-1H-indole is sourced from PubChem (CID 118908922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).