C31H30F3NO3S — CID 118908949
[4-cyclopropyl-1,1,1-trifluoro-3-[1-(methoxymethyl)-6-methyl-2-phenylindol-3-yl]butan-2-yl]oxy-phenoxymethanethione (PubChem CID 118908949) has the molecular formula C31H30F3NO3S and a molecular weight of 553.65 g/mol. Its IUPAC name is [4-cyclopropyl-1,1,1-trifluoro-3-[1-(methoxymethyl)-6-methyl-2-phenylindol-3-yl]butan-2-yl]oxy-phenoxymethanethione.
| Compound Name | [4-cyclopropyl-1,1,1-trifluoro-3-[1-(methoxymethyl)-6-methyl-2-phenylindol-3-yl]butan-2-yl]oxy-phenoxymethanethione |
|---|---|
| PubChem CID | 118908949 |
| Molecular Formula | C31H30F3NO3S |
| Molecular Weight | 553.65 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | [4-cyclopropyl-1,1,1-trifluoro-3-[1-(methoxymethyl)-6-methyl-2-phenylindol-3-yl]butan-2-yl]oxy-phenoxymethanethione |
| SMILES | COCn1c(-c2ccccc2)c(C(CC2CC2)C(OC(=S)Oc2ccccc2)C(F)(F)F)c2ccc(C)cc21 |
| InChI | InChI=1S/C31H30F3NO3S/c1-20-13-16-24-26(17-20)35(19-36-2)28(22-9-5-3-6-10-22)27(24)25(18-21-14-15-21)29(31(32,33)34)38-30(39)37-23-11-7-4-8-12-23/h3-13,16-17,21,25,29H,14-15,18-19H2,1-2H3 |
| InChIKey | SQBMBNKOSUAEOE-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.65 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|