C17H22N2 — CID 118909073
(1S,9S)-8,16-dimethyl-13-methylidene-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene (PubChem CID 118909073) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is (1S,9S)-8,16-dimethyl-13-methylidene-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene.
| Compound Name | (1S,9S)-8,16-dimethyl-13-methylidene-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene |
|---|---|
| PubChem CID | 118909073 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | (1S,9S)-8,16-dimethyl-13-methylidene-8,16-diazatetracyclo[7.4.3.01,9.02,7]hexadeca-2,4,6-triene |
| SMILES | C=C1CCC[C@@]23N(C)CC[C@@]12c1ccccc1N3C |
| InChI | InChI=1S/C17H22N2/c1-13-7-6-10-17-16(13,11-12-18(17)2)14-8-4-5-9-15(14)19(17)3/h4-5,8-9H,1,6-7,10-12H2,2-3H3/t16-,17-/m0/s1 |
| InChIKey | KIOWGZRBYYPTON-IRXDYDNUSA-N |
| XLogP | 3.15 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|