C13H23N2O2S+ — CID 11890908
1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfonylpiperazin-1-ium (PubChem CID 11890908) has the molecular formula C13H23N2O2S+ and a molecular weight of 271.41 g/mol. Its IUPAC name is 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfonylpiperazin-1-ium.
| Compound Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfonylpiperazin-1-ium |
|---|---|
| PubChem CID | 11890908 |
| Molecular Formula | C13H23N2O2S+ |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-[[(1R,2R,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-methylsulfonylpiperazin-1-ium |
| SMILES | CS(=O)(=O)N1CC[NH+](C[C@@H]2C[C@@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C13H22N2O2S/c1-18(16,17)15-6-4-14(5-7-15)10-13-9-11-2-3-12(13)8-11/h2-3,11-13H,4-10H2,1H3/p+1/t11-,12+,13+/m1/s1 |
| InChIKey | SQEPXEYASAOAHF-AGIUHOORSA-O |
| XLogP | -0.64 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|