C32H40F6O8 — CID 118909104
[1'-(2,2-difluoropropoxycarbonyl)spiro[1,3-dioxolane-2,4'-adamantane]-4-yl]methyl 5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carboxylate (PubChem CID 118909104) has the molecular formula C32H40F6O8 and a molecular weight of 666.65 g/mol. Its IUPAC name is [1'-(2,2-difluoropropoxycarbonyl)spiro[1,3-dioxolane-2,4'-adamantane]-4-yl]methyl 5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carboxylate.
| Compound Name | [1'-(2,2-difluoropropoxycarbonyl)spiro[1,3-dioxolane-2,4'-adamantane]-4-yl]methyl 5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carboxylate |
|---|---|
| PubChem CID | 118909104 |
| Molecular Formula | C32H40F6O8 |
| Molecular Weight | 666.65 g/mol |
| Exact Mass | 666.26 |
| IUPAC Name | [1'-(2,2-difluoropropoxycarbonyl)spiro[1,3-dioxolane-2,4'-adamantane]-4-yl]methyl 5,5,6,6-tetrafluorospiro[1,3-dioxepane-2,4'-adamantane]-1'-carboxylate |
| SMILES | CC(F)(F)COC(=O)C12CC3CC(C1)C1(OCC(COC(=O)C45CC6CC(C4)C4(OCC(F)(F)C(F)(F)CO4)C(C6)C5)O1)C(C3)C2 |
| InChI | InChI=1S/C32H40F6O8/c1-26(33,34)14-42-25(40)28-7-18-4-21(10-28)32(22(5-18)11-28)43-13-23(46-32)12-41-24(39)27-6-17-2-19(8-27)31(20(3-17)9-27)44-15-29(35,36)30(37,38)16-45-31/h17-23H,2-16H2,1H3 |
| InChIKey | JWGAPRSEPWTZFW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.65 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|