C26H34FN9O — CID 118909172
1-[2-cyclopropyl-5-[[5-fluoro-4-[(5,5,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-methyltetrazol-5-one (PubChem CID 118909172) has the molecular formula C26H34FN9O and a molecular weight of 507.62 g/mol. Its IUPAC name is 1-[2-cyclopropyl-5-[[5-fluoro-4-[(5,5,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-cyclopropyl-5-[[5-fluoro-4-[(5,5,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 118909172 |
| Molecular Formula | C26H34FN9O |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 1-[2-cyclopropyl-5-[[5-fluoro-4-[(5,5,8-trimethyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-7-yl)amino]pyrimidin-2-yl]amino]phenyl]-4-methyltetrazol-5-one |
| SMILES | CC1C(Nc2nc(Nc3ccc(C4CC4)c(-n4nnn(C)c4=O)c3)ncc2F)CC(C)(C)N2CCCC12 |
| InChI | InChI=1S/C26H34FN9O/c1-15-20(13-26(2,3)35-11-5-6-21(15)35)30-23-19(27)14-28-24(31-23)29-17-9-10-18(16-7-8-16)22(12-17)36-25(37)34(4)32-33-36/h9-10,12,14-16,20-21H,5-8,11,13H2,1-4H3,(H2,28,29,30,31) |
| InChIKey | HNARQPRUPYMVDE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |