About (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid
(2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 118910618) has the molecular formula C9H16O5
and a molecular weight of 204.22 g/mol. Its IUPAC name is (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid.
Molecular Properties
| Compound Name | (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid |
| PubChem CID | 118910618 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid |
| SMILES | CCCCOC[C@@H]1OC[C@@H](C(=O)O)O1 |
| InChI | InChI=1S/C9H16O5/c1-2-3-4-12-6-8-13-5-7(14-8)9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/t7-,8+/m0/s1 |
| InChIKey | COMLDRJZECQXKB-JGVFFNPUSA-N |
| XLogP | 0.63 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid (CID 118910618) is (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid is CCCCOC[C@@H]1OC[C@@H](C(=O)O)O1.
What is the InChIKey of (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid?
The InChIKey is COMLDRJZECQXKB-JGVFFNPUSA-N. The full InChI is InChI=1S/C9H16O5/c1-2-3-4-12-6-8-13-5-7(14-8)9(10)11/h7-8H,2-6H2,1H3,(H,10,11)/t7-,8+/m0/s1.
What are the key properties of (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid?
(2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid has a molecular weight of 204.22 g/mol, XLogP of 0.63, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,4S)-2-(butoxymethyl)-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 118910618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).