About (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile
(2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile (PubChem CID 118910776) has the molecular formula C10H13NOS
and a molecular weight of 195.29 g/mol. Its IUPAC name is (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile |
| PubChem CID | 118910776 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile |
| SMILES | C=C(C)/C=C\C(C#N)=C/CS(C)=O |
| InChI | InChI=1S/C10H13NOS/c1-9(2)4-5-10(8-11)6-7-13(3)12/h4-6H,1,7H2,2-3H3/b5-4-,10-6+ |
| InChIKey | DPKINVLSCNVCMC-VWJYOPCBSA-N |
| XLogP | 1.95 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile?
The IUPAC name of (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile (CID 118910776) is (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile.
What is the SMILES notation for (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile?
The canonical SMILES for (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile is C=C(C)/C=C\C(C#N)=C/CS(C)=O.
What is the InChIKey of (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile?
The InChIKey is DPKINVLSCNVCMC-VWJYOPCBSA-N. The full InChI is InChI=1S/C10H13NOS/c1-9(2)4-5-10(8-11)6-7-13(3)12/h4-6H,1,7H2,2-3H3/b5-4-,10-6+.
What are the key properties of (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile?
(2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile has a molecular weight of 195.29 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-5-methyl-2-(2-methylsulfinylethylidene)hexa-3,5-dienenitrile is sourced from PubChem (CID 118910776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).