C23H37N5O7 — CID 118910928
benzyl N-amino-N-[5-[(2S,4R,5S)-3-azido-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate (PubChem CID 118910928) has the molecular formula C23H37N5O7 and a molecular weight of 495.58 g/mol. Its IUPAC name is benzyl N-amino-N-[5-[(2S,4R,5S)-3-azido-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate.
| Compound Name | benzyl N-amino-N-[5-[(2S,4R,5S)-3-azido-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate |
|---|---|
| PubChem CID | 118910928 |
| Molecular Formula | C23H37N5O7 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | benzyl N-amino-N-[5-[(2S,4R,5S)-3-azido-4-butoxy-5-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxypentyl]carbamate |
| SMILES | CCCCO[C@@H]1C(N=[N+]=[N-])[C@@H](OCCCCCN(N)C(=O)OCc2ccccc2)OC(CO)[C@H]1O |
| InChI | InChI=1S/C23H37N5O7/c1-2-3-13-32-21-19(26-27-24)22(35-18(15-29)20(21)30)33-14-9-5-8-12-28(25)23(31)34-16-17-10-6-4-7-11-17/h4,6-7,10-11,18-22,29-30H,2-3,5,8-9,12-16,25H2,1H3/t18?,19?,20-,21-,22+/m1/s1 |
| InChIKey | LHPPMUAWQBXWDT-CDQBWFRLSA-N |
| XLogP | 2.63 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|