About [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol
[6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol (PubChem CID 118911219) has the molecular formula C19H23N3O3
and a molecular weight of 341.41 g/mol. Its IUPAC name is [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol.
Molecular Properties
| Compound Name | [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol |
| PubChem CID | 118911219 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol |
| SMILES | C[C@@H](c1ccc2c(c1)OCO2)N1CCN(c2ccc(CO)cn2)CC1 |
| InChI | InChI=1S/C19H23N3O3/c1-14(16-3-4-17-18(10-16)25-13-24-17)21-6-8-22(9-7-21)19-5-2-15(12-23)11-20-19/h2-5,10-11,14,23H,6-9,12-13H2,1H3/t14-/m0/s1 |
| InChIKey | XPRBZSSRUOEIPN-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol?
The IUPAC name of [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol (CID 118911219) is [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol.
What is the SMILES notation for [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol?
The canonical SMILES for [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol is C[C@@H](c1ccc2c(c1)OCO2)N1CCN(c2ccc(CO)cn2)CC1.
What is the InChIKey of [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol?
The InChIKey is XPRBZSSRUOEIPN-AWEZNQCLSA-N. The full InChI is InChI=1S/C19H23N3O3/c1-14(16-3-4-17-18(10-16)25-13-24-17)21-6-8-22(9-7-21)19-5-2-15(12-23)11-20-19/h2-5,10-11,14,23H,6-9,12-13H2,1H3/t14-/m0/s1.
What are the key properties of [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol?
[6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol has a molecular weight of 341.41 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-pyridinyl]methanol is sourced from PubChem (CID 118911219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).