C25H17F2NOS — CID 118911866
4-[3,5-bis(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]but-3-yn-1-ol (PubChem CID 118911866) has the molecular formula C25H17F2NOS and a molecular weight of 417.48 g/mol. Its IUPAC name is 4-[3,5-bis(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]but-3-yn-1-ol.
| Compound Name | 4-[3,5-bis(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 118911866 |
| Molecular Formula | C25H17F2NOS |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 4-[3,5-bis(4-fluorophenyl)-4-pyridin-4-ylthiophen-2-yl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1sc(-c2ccc(F)cc2)c(-c2ccncc2)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H17F2NOS/c26-20-8-4-17(5-9-20)23-22(3-1-2-16-29)30-25(19-6-10-21(27)11-7-19)24(23)18-12-14-28-15-13-18/h4-15,29H,2,16H2 |
| InChIKey | DONXSQYGLCOMLQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|