C32H48N4O8 — CID 118911927
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 118911927) has the molecular formula C32H48N4O8 and a molecular weight of 616.76 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 118911927 |
| Molecular Formula | C32H48N4O8 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.35 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCN2C(=O)C3CCCCC3C2=O)CC(C)(CNC(=O)OCCN2C(=O)C3CCCCC3C2=O)C1 |
| InChI | InChI=1S/C32H48N4O8/c1-31(2)16-20(34-30(42)44-15-13-36-27(39)23-10-6-7-11-24(23)28(36)40)17-32(3,18-31)19-33-29(41)43-14-12-35-25(37)21-8-4-5-9-22(21)26(35)38/h20-24H,4-19H2,1-3H3,(H,33,41)(H,34,42) |
| InChIKey | GZVJVIUKDGUAHC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 151.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|