C33H49N3O8 — CID 118911977
2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 118911977) has the molecular formula C33H49N3O8 and a molecular weight of 615.77 g/mol. Its IUPAC name is 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 118911977 |
| Molecular Formula | C33H49N3O8 |
| Molecular Weight | 615.77 g/mol |
| Exact Mass | 615.35 |
| IUPAC Name | 2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)ethyl N-[3-[[2-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroinden-2-yl)ethoxycarbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CC1(C)CC(NC(=O)OCCN2C(=O)C3CCCCC3C2=O)CC(C)(CNC(=O)OCCC2C(=O)C3CCCCC3C2=O)C1 |
| InChI | InChI=1S/C33H49N3O8/c1-32(2)16-20(35-31(42)44-15-13-36-28(39)23-10-6-7-11-24(23)29(36)40)17-33(3,18-32)19-34-30(41)43-14-12-25-26(37)21-8-4-5-9-22(21)27(25)38/h20-25H,4-19H2,1-3H3,(H,34,41)(H,35,42) |
| InChIKey | ZXSNHQAVHMLVTG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 148.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.77 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|