C41H72N4O8 — CID 118912004
1-O,1-O,2-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) 2-O-(1,5,5-trimethylpiperidin-3-yl) ethane-1,1,2,2-tetracarboxylate (PubChem CID 118912004) has the molecular formula C41H72N4O8 and a molecular weight of 749.05 g/mol. Its IUPAC name is 1-O,1-O,2-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) 2-O-(1,5,5-trimethylpiperidin-3-yl) ethane-1,1,2,2-tetracarboxylate.
| Compound Name | 1-O,1-O,2-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) 2-O-(1,5,5-trimethylpiperidin-3-yl) ethane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 118912004 |
| Molecular Formula | C41H72N4O8 |
| Molecular Weight | 749.05 g/mol |
| Exact Mass | 748.54 |
| IUPAC Name | 1-O,1-O,2-O-tris(2,2,6,6-tetramethylpiperidin-4-yl) 2-O-(1,5,5-trimethylpiperidin-3-yl) ethane-1,1,2,2-tetracarboxylate |
| SMILES | CN1CC(OC(=O)C(C(=O)OC2CC(C)(C)NC(C)(C)C2)C(C(=O)OC2CC(C)(C)NC(C)(C)C2)C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)C1 |
| InChI | InChI=1S/C41H72N4O8/c1-35(2)16-28(23-45(15)24-35)53-34(49)30(33(48)52-27-21-40(11,12)44-41(13,14)22-27)29(31(46)50-25-17-36(3,4)42-37(5,6)18-25)32(47)51-26-19-38(7,8)43-39(9,10)20-26/h25-30,42-44H,16-24H2,1-15H3 |
| InChIKey | JPAZPIHOHPMROC-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 144.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|