C13H15I3N2O5 — CID 118912055
2,5-diamino-5-oxo-3-[2-(2,4,6-triiodophenoxy)ethoxy]pentanoic acid (PubChem CID 118912055) has the molecular formula C13H15I3N2O5 and a molecular weight of 659.98 g/mol. Its IUPAC name is 2,5-diamino-5-oxo-3-[2-(2,4,6-triiodophenoxy)ethoxy]pentanoic acid.
| Compound Name | 2,5-diamino-5-oxo-3-[2-(2,4,6-triiodophenoxy)ethoxy]pentanoic acid |
|---|---|
| PubChem CID | 118912055 |
| Molecular Formula | C13H15I3N2O5 |
| Molecular Weight | 659.98 g/mol |
| Exact Mass | 659.81 |
| IUPAC Name | 2,5-diamino-5-oxo-3-[2-(2,4,6-triiodophenoxy)ethoxy]pentanoic acid |
| SMILES | NC(=O)CC(OCCOc1c(I)cc(I)cc1I)C(N)C(=O)O |
| InChI | InChI=1S/C13H15I3N2O5/c14-6-3-7(15)12(8(16)4-6)23-2-1-22-9(5-10(17)19)11(18)13(20)21/h3-4,9,11H,1-2,5,18H2,(H2,17,19)(H,20,21) |
| InChIKey | IDNWQJIORQXUDG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.98 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|