C19H22F3N5O — CID 118912078
(11bR)-N-[6-methyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-amine (PubChem CID 118912078) has the molecular formula C19H22F3N5O and a molecular weight of 393.41 g/mol. Its IUPAC name is (11bR)-N-[6-methyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-amine.
| Compound Name | (11bR)-N-[6-methyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-amine |
|---|---|
| PubChem CID | 118912078 |
| Molecular Formula | C19H22F3N5O |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | (11bR)-N-[6-methyl-2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-9-amine |
| SMILES | Cc1cc(Nc2ccc3c(c2)CCN2CCNC[C@@H]32)nc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C19H22F3N5O/c1-12-8-17(26-18(24-12)28-11-19(20,21)22)25-14-2-3-15-13(9-14)4-6-27-7-5-23-10-16(15)27/h2-3,8-9,16,23H,4-7,10-11H2,1H3,(H,24,25,26)/t16-/m0/s1 |
| InChIKey | CIEVZTFXDZYXLC-INIZCTEOSA-N |
| XLogP | 2.97 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |