C43H65F5O4S — CID 118912105
[3-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (E)-undec-2-enoate (PubChem CID 118912105) has the molecular formula C43H65F5O4S and a molecular weight of 773.05 g/mol. Its IUPAC name is [3-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (E)-undec-2-enoate.
| Compound Name | [3-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (E)-undec-2-enoate |
|---|---|
| PubChem CID | 118912105 |
| Molecular Formula | C43H65F5O4S |
| Molecular Weight | 773.05 g/mol |
| Exact Mass | 772.45 |
| IUPAC Name | [3-hydroxy-13-methyl-7-[9-(4,4,5,5,5-pentafluoropentylsulfinyl)nonyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] (E)-undec-2-enoate |
| SMILES | CCCCCCCC/C=C/C(=O)OC1CCC2C3C(CCCCCCCCCS(=O)CCCC(F)(F)C(F)(F)F)Cc4cc(O)ccc4C3CCC12C |
| InChI | InChI=1S/C43H65F5O4S/c1-3-4-5-6-7-10-13-16-20-39(50)52-38-24-23-37-40-32(30-33-31-34(49)21-22-35(33)36(40)25-27-41(37,38)2)19-15-12-9-8-11-14-17-28-53(51)29-18-26-42(44,45)43(46,47)48/h16,20-22,31-32,36-38,40,49H,3-15,17-19,23-30H2,1-2H3/b20-16+ |
| InChIKey | YWGCHMQMMHMQTC-CAPFRKAQSA-N |
| XLogP | 12.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.05 |
| LogP ≤ 5 | 12.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|