About N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide
N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide (PubChem CID 118912261) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide.
Molecular Properties
| Compound Name | N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide |
| PubChem CID | 118912261 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide |
| SMILES | CCC(=O)NC[C@@H]1C[C@H]1c1cccc(C)c1CC=O |
| InChI | InChI=1S/C16H21NO2/c1-3-16(19)17-10-12-9-15(12)14-6-4-5-11(2)13(14)7-8-18/h4-6,8,12,15H,3,7,9-10H2,1-2H3,(H,17,19)/t12-,15+/m0/s1 |
| InChIKey | GLWOQGLPLQSLEA-SWLSCSKDSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide?
The IUPAC name of N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide (CID 118912261) is N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide.
What is the SMILES notation for N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide?
The canonical SMILES for N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide is CCC(=O)NC[C@@H]1C[C@H]1c1cccc(C)c1CC=O.
What is the InChIKey of N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide?
The InChIKey is GLWOQGLPLQSLEA-SWLSCSKDSA-N. The full InChI is InChI=1S/C16H21NO2/c1-3-16(19)17-10-12-9-15(12)14-6-4-5-11(2)13(14)7-8-18/h4-6,8,12,15H,3,7,9-10H2,1-2H3,(H,17,19)/t12-,15+/m0/s1.
What are the key properties of N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide?
N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide has a molecular weight of 259.35 g/mol, XLogP of 2.37, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,2R)-2-[3-methyl-2-(2-oxoethyl)phenyl]cyclopropyl]methyl]propanamide is sourced from PubChem (CID 118912261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).