C19H17ClN3O2S+ — CID 118912484
6-(6-chloro-3-pyridinyl)-1-ethyl-2-hydroxy-3-phenyl-6,8-dihydro-[1,3]thiazolo[3,4-a]pyrimidin-1-ium-4-one (PubChem CID 118912484) has the molecular formula C19H17ClN3O2S+ and a molecular weight of 386.88 g/mol. Its IUPAC name is 6-(6-chloro-3-pyridinyl)-1-ethyl-2-hydroxy-3-phenyl-6,8-dihydro-[1,3]thiazolo[3,4-a]pyrimidin-1-ium-4-one.
| Compound Name | 6-(6-chloro-3-pyridinyl)-1-ethyl-2-hydroxy-3-phenyl-6,8-dihydro-[1,3]thiazolo[3,4-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 118912484 |
| Molecular Formula | C19H17ClN3O2S+ |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | 6-(6-chloro-3-pyridinyl)-1-ethyl-2-hydroxy-3-phenyl-6,8-dihydro-[1,3]thiazolo[3,4-a]pyrimidin-1-ium-4-one |
| SMILES | CC[n+]1c(O)c(-c2ccccc2)c(=O)n2c1CSC2c1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H16ClN3O2S/c1-2-22-15-11-26-19(13-8-9-14(20)21-10-13)23(15)18(25)16(17(22)24)12-6-4-3-5-7-12/h3-10,19H,2,11H2,1H3/p+1 |
| InChIKey | YWJRUOGDIGLHRM-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|