C40H47N3O3 — CID 118912679
4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(4-phenylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile (PubChem CID 118912679) has the molecular formula C40H47N3O3 and a molecular weight of 617.83 g/mol. Its IUPAC name is 4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(4-phenylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile.
| Compound Name | 4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(4-phenylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
|---|---|
| PubChem CID | 118912679 |
| Molecular Formula | C40H47N3O3 |
| Molecular Weight | 617.83 g/mol |
| Exact Mass | 617.36 |
| IUPAC Name | 4,4,6a,6b,11,11,14b-heptamethyl-3,13-dioxo-8a-(4-phenylimidazole-1-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-2-carbonitrile |
| SMILES | CC1(C)CCC2(C(=O)n3cnc(-c4ccccc4)c3)CCC3(C)C(C(=O)C=C4C5(C)C=C(C#N)C(=O)C(C)(C)C5CCC43C)C2C1 |
| InChI | InChI=1S/C40H47N3O3/c1-35(2)15-17-40(34(46)43-23-28(42-24-43)25-11-9-8-10-12-25)18-16-39(7)32(27(40)21-35)29(44)19-31-37(5)20-26(22-41)33(45)36(3,4)30(37)13-14-38(31,39)6/h8-12,19-20,23-24,27,30,32H,13-18,21H2,1-7H3 |
| InChIKey | IEIMYFGFFZSRHW-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 92.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.83 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |