About 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol
2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol (PubChem CID 118912777) has the molecular formula C9H14F6O2
and a molecular weight of 268.20 g/mol. Its IUPAC name is 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol.
Molecular Properties
| Compound Name | 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol |
| PubChem CID | 118912777 |
| Molecular Formula | C9H14F6O2 |
| Molecular Weight | 268.20 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol |
| SMILES | CCCCC(OCCO)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H14F6O2/c1-2-3-4-7(8(10,11)12,9(13,14)15)17-6-5-16/h16H,2-6H2,1H3 |
| InChIKey | DVRCDMRSRSXBHQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.20 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol?
The IUPAC name of 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol (CID 118912777) is 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol.
What is the SMILES notation for 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol?
The canonical SMILES for 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol is CCCCC(OCCO)(C(F)(F)F)C(F)(F)F.
What is the InChIKey of 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol?
The InChIKey is DVRCDMRSRSXBHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F6O2/c1-2-3-4-7(8(10,11)12,9(13,14)15)17-6-5-16/h16H,2-6H2,1H3.
What are the key properties of 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol?
2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol has a molecular weight of 268.20 g/mol, XLogP of 3.05, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,1,1-trifluoro-2-(trifluoromethyl)hexan-2-yl]oxyethanol is sourced from PubChem (CID 118912777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).