About 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole
6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole (PubChem CID 118913085) has the molecular formula C16H23N3
and a molecular weight of 257.38 g/mol. Its IUPAC name is 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole.
Molecular Properties
| Compound Name | 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole |
| PubChem CID | 118913085 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole |
| SMILES | Cc1cn(C)c2cc(N3CC(C)NC(C)C3)ccc12 |
| InChI | InChI=1S/C16H23N3/c1-11-8-18(4)16-7-14(5-6-15(11)16)19-9-12(2)17-13(3)10-19/h5-8,12-13,17H,9-10H2,1-4H3 |
| InChIKey | LPAQLDKXXSTIRZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole?
The IUPAC name of 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole (CID 118913085) is 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole.
What is the SMILES notation for 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole?
The canonical SMILES for 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole is Cc1cn(C)c2cc(N3CC(C)NC(C)C3)ccc12.
What is the InChIKey of 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole?
The InChIKey is LPAQLDKXXSTIRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3/c1-11-8-18(4)16-7-14(5-6-15(11)16)19-9-12(2)17-13(3)10-19/h5-8,12-13,17H,9-10H2,1-4H3.
What are the key properties of 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole?
6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole has a molecular weight of 257.38 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethylpiperazin-1-yl)-1,3-dimethylindole is sourced from PubChem (CID 118913085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).